C7H7N5O6 — CID 71424145
N-ethyl-2,4,6-trinitropyridin-3-amine (PubChem CID 71424145) has the molecular formula C7H7N5O6 and a molecular weight of 257.16 g/mol. Its IUPAC name is N-ethyl-2,4,6-trinitropyridin-3-amine.
| Compound Name | N-ethyl-2,4,6-trinitropyridin-3-amine |
|---|---|
| PubChem CID | 71424145 |
| Molecular Formula | C7H7N5O6 |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | N-ethyl-2,4,6-trinitropyridin-3-amine |
| SMILES | CCNc1c([N+](=O)[O-])cc([N+](=O)[O-])nc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7N5O6/c1-2-8-6-4(10(13)14)3-5(11(15)16)9-7(6)12(17)18/h3,8H,2H2,1H3 |
| InChIKey | STZYMBCUQXEVPP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 154.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|