C14H22N2O4 — CID 96710244
N-ethyl-5-nitro-2,4-dipropoxyaniline (PubChem CID 96710244) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-ethyl-5-nitro-2,4-dipropoxyaniline.
| Compound Name | N-ethyl-5-nitro-2,4-dipropoxyaniline |
|---|---|
| PubChem CID | 96710244 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-ethyl-5-nitro-2,4-dipropoxyaniline |
| SMILES | CCCOc1cc(OCCC)c([N+](=O)[O-])cc1NCC |
| InChI | InChI=1S/C14H22N2O4/c1-4-7-19-13-10-14(20-8-5-2)12(16(17)18)9-11(13)15-6-3/h9-10,15H,4-8H2,1-3H3 |
| InChIKey | BBSJDDNXTUHCAQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|