C14H23NO2 — CID 82267866
N-ethyl-2,5-dipropoxyaniline (PubChem CID 82267866) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is N-ethyl-2,5-dipropoxyaniline.
| Compound Name | N-ethyl-2,5-dipropoxyaniline |
|---|---|
| PubChem CID | 82267866 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | N-ethyl-2,5-dipropoxyaniline |
| SMILES | CCCOc1ccc(OCCC)c(NCC)c1 |
| InChI | InChI=1S/C14H23NO2/c1-4-9-16-12-7-8-14(17-10-5-2)13(11-12)15-6-3/h7-8,11,15H,4-6,9-10H2,1-3H3 |
| InChIKey | XBSZWBHXXMUDMO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |