C22H30N2O4Si2 — CID 91745178
trimethylsilyl 5-oxo-7-propan-2-yl-2-(trimethylsilylamino)chromeno[2,3-b]pyridine-3-carboxylate (PubChem CID 91745178) has the molecular formula C22H30N2O4Si2 and a molecular weight of 442.66 g/mol. Its IUPAC name is trimethylsilyl 5-oxo-7-propan-2-yl-2-(trimethylsilylamino)chromeno[2,3-b]pyridine-3-carboxylate.
| Compound Name | trimethylsilyl 5-oxo-7-propan-2-yl-2-(trimethylsilylamino)chromeno[2,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 91745178 |
| Molecular Formula | C22H30N2O4Si2 |
| Molecular Weight | 442.66 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | trimethylsilyl 5-oxo-7-propan-2-yl-2-(trimethylsilylamino)chromeno[2,3-b]pyridine-3-carboxylate |
| SMILES | CC(C)c1ccc2oc3nc(N[Si](C)(C)C)c(C(=O)O[Si](C)(C)C)cc3c(=O)c2c1 |
| InChI | InChI=1S/C22H30N2O4Si2/c1-13(2)14-9-10-18-15(11-14)19(25)16-12-17(22(26)28-30(6,7)8)20(23-21(16)27-18)24-29(3,4)5/h9-13H,1-8H3,(H,23,24) |
| InChIKey | AKPWYGCIBJTNOU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.66 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|