C16H13NO5 — CID 1475272
methyl 2-(methoxymethyl)-5-oxochromeno[2,3-b]pyridine-3-carboxylate (PubChem CID 1475272) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is methyl 2-(methoxymethyl)-5-oxochromeno[2,3-b]pyridine-3-carboxylate.
| Compound Name | methyl 2-(methoxymethyl)-5-oxochromeno[2,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 1475272 |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | methyl 2-(methoxymethyl)-5-oxochromeno[2,3-b]pyridine-3-carboxylate |
| SMILES | COCc1nc2oc3ccccc3c(=O)c2cc1C(=O)OC |
| InChI | InChI=1S/C16H13NO5/c1-20-8-12-10(16(19)21-2)7-11-14(18)9-5-3-4-6-13(9)22-15(11)17-12/h3-7H,8H2,1-2H3 |
| InChIKey | UENANUSSLJFSAR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|