C23H19NO4 — CID 7747356
benzyl 7-ethyl-2-methyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate (PubChem CID 7747356) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is benzyl 7-ethyl-2-methyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate.
| Compound Name | benzyl 7-ethyl-2-methyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 7747356 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | benzyl 7-ethyl-2-methyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate |
| SMILES | CCc1ccc2oc3nc(C)c(C(=O)OCc4ccccc4)cc3c(=O)c2c1 |
| InChI | InChI=1S/C23H19NO4/c1-3-15-9-10-20-18(11-15)21(25)19-12-17(14(2)24-22(19)28-20)23(26)27-13-16-7-5-4-6-8-16/h4-12H,3,13H2,1-2H3 |
| InChIKey | IZKAXXIQIVXYRF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|