C21H24N2O4 — CID 130276879
ethyl 2-amino-7-(3,3-dimethylbutyl)-5-oxochromeno[2,3-b]pyridine-3-carboxylate (PubChem CID 130276879) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is ethyl 2-amino-7-(3,3-dimethylbutyl)-5-oxochromeno[2,3-b]pyridine-3-carboxylate.
| Compound Name | ethyl 2-amino-7-(3,3-dimethylbutyl)-5-oxochromeno[2,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 130276879 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | ethyl 2-amino-7-(3,3-dimethylbutyl)-5-oxochromeno[2,3-b]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)c3cc(CCC(C)(C)C)ccc3oc2nc1N |
| InChI | InChI=1S/C21H24N2O4/c1-5-26-20(25)15-11-14-17(24)13-10-12(8-9-21(2,3)4)6-7-16(13)27-19(14)23-18(15)22/h6-7,10-11H,5,8-9H2,1-4H3,(H2,22,23) |
| InChIKey | SYBPHNUSIHPYBQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|