C16H13NO4 — CID 12689284
methyl 7-ethyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate (PubChem CID 12689284) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is methyl 7-ethyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate.
| Compound Name | methyl 7-ethyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 12689284 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | methyl 7-ethyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate |
| SMILES | CCc1ccc2oc3ncc(C(=O)OC)cc3c(=O)c2c1 |
| InChI | InChI=1S/C16H13NO4/c1-3-9-4-5-13-11(6-9)14(18)12-7-10(16(19)20-2)8-17-15(12)21-13/h4-8H,3H2,1-2H3 |
| InChIKey | NRDKIJYAQJQGHC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|