C25H22BF4NO3 — CID 2793149
(6-ethyl-2-phenylchromen-4-ylidene)-(4-methoxycarbonylphenyl)azanium tetrafluoroborate (PubChem CID 2793149) has the molecular formula C25H22BF4NO3 and a molecular weight of 471.26 g/mol. Its IUPAC name is (6-ethyl-2-phenylchromen-4-ylidene)-(4-methoxycarbonylphenyl)azanium tetrafluoroborate.
| Compound Name | (6-ethyl-2-phenylchromen-4-ylidene)-(4-methoxycarbonylphenyl)azanium tetrafluoroborate |
|---|---|
| PubChem CID | 2793149 |
| Molecular Formula | C25H22BF4NO3 |
| Molecular Weight | 471.26 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | (6-ethyl-2-phenylchromen-4-ylidene)-(4-methoxycarbonylphenyl)azanium tetrafluoroborate |
| SMILES | CCc1ccc2oc(-c3ccccc3)c/c(=[NH+]\c3ccc(C(=O)OC)cc3)c2c1.F[B-](F)(F)F |
| InChI | InChI=1S/C25H21NO3.BF4/c1-3-17-9-14-23-21(15-17)22(16-24(29-23)18-7-5-4-6-8-18)26-20-12-10-19(11-13-20)25(27)28-2;2-1(3,4)5/h4-16H,3H2,1-2H3;/q;-1/p+1/b26-22+; |
| InChIKey | AYEDPCMFFQAEJS-LIUXSCBKSA-O |
| XLogP | 5.06 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.26 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|