C34H27BF4N2O5 — CID 20997875
[4-[4-(1,3-dioxoisoindol-2-yl)butanoyloxy]phenyl]-(6-methyl-2-phenylchromen-4-ylidene)azanium tetrafluoroborate (PubChem CID 20997875) has the molecular formula C34H27BF4N2O5 and a molecular weight of 630.40 g/mol. Its IUPAC name is [4-[4-(1,3-dioxoisoindol-2-yl)butanoyloxy]phenyl]-(6-methyl-2-phenylchromen-4-ylidene)azanium tetrafluoroborate.
| Compound Name | [4-[4-(1,3-dioxoisoindol-2-yl)butanoyloxy]phenyl]-(6-methyl-2-phenylchromen-4-ylidene)azanium tetrafluoroborate |
|---|---|
| PubChem CID | 20997875 |
| Molecular Formula | C34H27BF4N2O5 |
| Molecular Weight | 630.40 g/mol |
| Exact Mass | 630.19 |
| IUPAC Name | [4-[4-(1,3-dioxoisoindol-2-yl)butanoyloxy]phenyl]-(6-methyl-2-phenylchromen-4-ylidene)azanium tetrafluoroborate |
| SMILES | Cc1ccc2oc(-c3ccccc3)c/c(=[NH+]\c3ccc(OC(=O)CCCN4C(=O)c5ccccc5C4=O)cc3)c2c1.F[B-](F)(F)F |
| InChI | InChI=1S/C34H26N2O5.BF4/c1-22-13-18-30-28(20-22)29(21-31(41-30)23-8-3-2-4-9-23)35-24-14-16-25(17-15-24)40-32(37)12-7-19-36-33(38)26-10-5-6-11-27(26)34(36)39;2-1(3,4)5/h2-6,8-11,13-18,20-21H,7,12,19H2,1H3;/q;-1/p+1/b35-29+; |
| InChIKey | OVWZLKHCBLNWJI-LQUFLZKLSA-O |
| XLogP | 6.00 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.40 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|