C33H25BF4N2O6 — CID 20997937
[4-[2-(1,3-dioxoisoindol-2-yl)acetyl]oxyphenyl]-[2-(4-methoxyphenyl)-6-methylchromen-4-ylidene]azanium tetrafluoroborate (PubChem CID 20997937) has the molecular formula C33H25BF4N2O6 and a molecular weight of 632.38 g/mol. Its IUPAC name is [4-[2-(1,3-dioxoisoindol-2-yl)acetyl]oxyphenyl]-[2-(4-methoxyphenyl)-6-methylchromen-4-ylidene]azanium tetrafluoroborate.
| Compound Name | [4-[2-(1,3-dioxoisoindol-2-yl)acetyl]oxyphenyl]-[2-(4-methoxyphenyl)-6-methylchromen-4-ylidene]azanium tetrafluoroborate |
|---|---|
| PubChem CID | 20997937 |
| Molecular Formula | C33H25BF4N2O6 |
| Molecular Weight | 632.38 g/mol |
| Exact Mass | 632.17 |
| IUPAC Name | [4-[2-(1,3-dioxoisoindol-2-yl)acetyl]oxyphenyl]-[2-(4-methoxyphenyl)-6-methylchromen-4-ylidene]azanium tetrafluoroborate |
| SMILES | COc1ccc(-c2c/c(=[NH+]\c3ccc(OC(=O)CN4C(=O)c5ccccc5C4=O)cc3)c3cc(C)ccc3o2)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C33H24N2O6.BF4/c1-20-7-16-29-27(17-20)28(18-30(41-29)21-8-12-23(39-2)13-9-21)34-22-10-14-24(15-11-22)40-31(36)19-35-32(37)25-5-3-4-6-26(25)33(35)38;2-1(3,4)5/h3-18H,19H2,1-2H3;/q;-1/p+1/b34-28+; |
| InChIKey | WLWZRPIDHOIBRL-RGEOXJBSSA-O |
| XLogP | 5.23 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|