C22H16BCl2F4NO2 — CID 23411877
(3,4-dichlorophenyl)-[2-(4-methoxyphenyl)chromen-4-ylidene]azanium tetrafluoroborate (PubChem CID 23411877) has the molecular formula C22H16BCl2F4NO2 and a molecular weight of 484.09 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[2-(4-methoxyphenyl)chromen-4-ylidene]azanium tetrafluoroborate.
| Compound Name | (3,4-dichlorophenyl)-[2-(4-methoxyphenyl)chromen-4-ylidene]azanium tetrafluoroborate |
|---|---|
| PubChem CID | 23411877 |
| Molecular Formula | C22H16BCl2F4NO2 |
| Molecular Weight | 484.09 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | (3,4-dichlorophenyl)-[2-(4-methoxyphenyl)chromen-4-ylidene]azanium tetrafluoroborate |
| SMILES | COc1ccc(-c2c/c(=[NH+]\c3ccc(Cl)c(Cl)c3)c3ccccc3o2)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C22H15Cl2NO2.BF4/c1-26-16-9-6-14(7-10-16)22-13-20(17-4-2-3-5-21(17)27-22)25-15-8-11-18(23)19(24)12-15;2-1(3,4)5/h2-13H,1H3;/q;-1/p+1/b25-20+; |
| InChIKey | SUVQZGIRKLDAPE-UDLBSFQBSA-O |
| XLogP | 6.03 |
| TPSA | 36.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.09 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|