C22H19BF4N2O2 — CID 23411909
[2-(4-methoxyphenyl)chromen-4-ylidene]-(pyridin-3-ylmethyl)azanium tetrafluoroborate (PubChem CID 23411909) has the molecular formula C22H19BF4N2O2 and a molecular weight of 430.21 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)chromen-4-ylidene]-(pyridin-3-ylmethyl)azanium tetrafluoroborate.
| Compound Name | [2-(4-methoxyphenyl)chromen-4-ylidene]-(pyridin-3-ylmethyl)azanium tetrafluoroborate |
|---|---|
| PubChem CID | 23411909 |
| Molecular Formula | C22H19BF4N2O2 |
| Molecular Weight | 430.21 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | [2-(4-methoxyphenyl)chromen-4-ylidene]-(pyridin-3-ylmethyl)azanium tetrafluoroborate |
| SMILES | COc1ccc(-c2c/c(=[NH+]\Cc3cccnc3)c3ccccc3o2)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C22H18N2O2.BF4/c1-25-18-10-8-17(9-11-18)22-13-20(19-6-2-3-7-21(19)26-22)24-15-16-5-4-12-23-14-16;2-1(3,4)5/h2-14H,15H2,1H3;/q;-1/p+1/b24-20+; |
| InChIKey | VQYROAQAADLDTN-UUTNPJQJSA-O |
| XLogP | 3.98 |
| TPSA | 49.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.21 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|