C23H21ClN2O5 — CID 20998139
[6-methyl-2-(4-methylphenyl)chromen-4-ylidene]-(pyridin-3-ylmethyl)azanium perchlorate (PubChem CID 20998139) has the molecular formula C23H21ClN2O5 and a molecular weight of 440.88 g/mol. Its IUPAC name is [6-methyl-2-(4-methylphenyl)chromen-4-ylidene]-(pyridin-3-ylmethyl)azanium perchlorate.
| Compound Name | [6-methyl-2-(4-methylphenyl)chromen-4-ylidene]-(pyridin-3-ylmethyl)azanium perchlorate |
|---|---|
| PubChem CID | 20998139 |
| Molecular Formula | C23H21ClN2O5 |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | [6-methyl-2-(4-methylphenyl)chromen-4-ylidene]-(pyridin-3-ylmethyl)azanium perchlorate |
| SMILES | Cc1ccc(-c2c/c(=[NH+]\Cc3cccnc3)c3cc(C)ccc3o2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H20N2O.ClHO4/c1-16-5-8-19(9-6-16)23-13-21(25-15-18-4-3-11-24-14-18)20-12-17(2)7-10-22(20)26-23;2-1(3,4)5/h3-14H,15H2,1-2H3;(H,2,3,4,5)/b25-21+; |
| InChIKey | GFLIGQPRDZGRTF-JMFMGIQESA-N |
| XLogP | -1.46 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |