C21H17Cl2NO6 — CID 20998172
[2-(4-chlorophenyl)-6-methylchromen-4-ylidene]-(furan-2-ylmethyl)azanium perchlorate (PubChem CID 20998172) has the molecular formula C21H17Cl2NO6 and a molecular weight of 450.27 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-6-methylchromen-4-ylidene]-(furan-2-ylmethyl)azanium perchlorate.
| Compound Name | [2-(4-chlorophenyl)-6-methylchromen-4-ylidene]-(furan-2-ylmethyl)azanium perchlorate |
|---|---|
| PubChem CID | 20998172 |
| Molecular Formula | C21H17Cl2NO6 |
| Molecular Weight | 450.27 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | [2-(4-chlorophenyl)-6-methylchromen-4-ylidene]-(furan-2-ylmethyl)azanium perchlorate |
| SMILES | Cc1ccc2oc(-c3ccc(Cl)cc3)c/c(=[NH+]\Cc3ccco3)c2c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C21H16ClNO2.ClHO4/c1-14-4-9-20-18(11-14)19(23-13-17-3-2-10-24-17)12-21(25-20)15-5-7-16(22)8-6-15;2-1(3,4)5/h2-12H,13H2,1H3;(H,2,3,4,5)/b23-19+; |
| InChIKey | QQXLOCKEOPXCIR-IMPZXOFZSA-N |
| XLogP | -0.92 |
| TPSA | 132.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.27 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |