C22H17NO4 — CID 108790263
N-(furan-2-ylmethyl)-4-(6-methyl-4-oxochromen-2-yl)benzamide (PubChem CID 108790263) has the molecular formula C22H17NO4 and a molecular weight of 359.38 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-(6-methyl-4-oxochromen-2-yl)benzamide.
| Compound Name | N-(furan-2-ylmethyl)-4-(6-methyl-4-oxochromen-2-yl)benzamide |
|---|---|
| PubChem CID | 108790263 |
| Molecular Formula | C22H17NO4 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-(6-methyl-4-oxochromen-2-yl)benzamide |
| SMILES | Cc1ccc2oc(-c3ccc(C(=O)NCc4ccco4)cc3)cc(=O)c2c1 |
| InChI | InChI=1S/C22H17NO4/c1-14-4-9-20-18(11-14)19(24)12-21(27-20)15-5-7-16(8-6-15)22(25)23-13-17-3-2-10-26-17/h2-12H,13H2,1H3,(H,23,25) |
| InChIKey | WYMZQRJZFCDKOI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |