C23H23NO7S — CID 108803156
4-ethylsulfonyl-2-[[4-(6-methyl-4-oxochromen-2-yl)benzoyl]amino]butanoic acid (PubChem CID 108803156) has the molecular formula C23H23NO7S and a molecular weight of 457.50 g/mol. Its IUPAC name is 4-ethylsulfonyl-2-[[4-(6-methyl-4-oxochromen-2-yl)benzoyl]amino]butanoic acid.
| Compound Name | 4-ethylsulfonyl-2-[[4-(6-methyl-4-oxochromen-2-yl)benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 108803156 |
| Molecular Formula | C23H23NO7S |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 4-ethylsulfonyl-2-[[4-(6-methyl-4-oxochromen-2-yl)benzoyl]amino]butanoic acid |
| SMILES | CCS(=O)(=O)CCC(NC(=O)c1ccc(-c2cc(=O)c3cc(C)ccc3o2)cc1)C(=O)O |
| InChI | InChI=1S/C23H23NO7S/c1-3-32(29,30)11-10-18(23(27)28)24-22(26)16-7-5-15(6-8-16)21-13-19(25)17-12-14(2)4-9-20(17)31-21/h4-9,12-13,18H,3,10-11H2,1-2H3,(H,24,26)(H,27,28) |
| InChIKey | GTMBUZPVNDCJSJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |