C22H16Cl2NO2+ — CID 4088155
(3-chloro-4-methoxyphenyl)-(6-chloro-2-phenylchromen-4-ylidene)azanium (PubChem CID 4088155) has the molecular formula C22H16Cl2NO2+ and a molecular weight of 397.28 g/mol. Its IUPAC name is (3-chloro-4-methoxyphenyl)-(6-chloro-2-phenylchromen-4-ylidene)azanium.
| Compound Name | (3-chloro-4-methoxyphenyl)-(6-chloro-2-phenylchromen-4-ylidene)azanium |
|---|---|
| PubChem CID | 4088155 |
| Molecular Formula | C22H16Cl2NO2+ |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | (3-chloro-4-methoxyphenyl)-(6-chloro-2-phenylchromen-4-ylidene)azanium |
| SMILES | COc1ccc(/[NH+]=c2\cc(-c3ccccc3)oc3ccc(Cl)cc23)cc1Cl |
| InChI | InChI=1S/C22H15Cl2NO2/c1-26-21-10-8-16(12-18(21)24)25-19-13-22(14-5-3-2-4-6-14)27-20-9-7-15(23)11-17(19)20/h2-13H,1H3/p+1/b25-19+ |
| InChIKey | UVVMXSHPUKOSFX-NCELDCMTSA-O |
| XLogP | 4.73 |
| TPSA | 36.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |