About 2-chloro-1-methoxy-4-methylbenzene;(2-phenylchromen-4-ylidene)azanium;tetrafluoroborate
2-chloro-1-methoxy-4-methylbenzene;(2-phenylchromen-4-ylidene)azanium;tetrafluoroborate (PubChem CID 23411826) has the molecular formula C23H21BClF4NO2
and a molecular weight of 465.68 g/mol. Its IUPAC name is 2-chloro-1-methoxy-4-methylbenzene;(2-phenylchromen-4-ylidene)azanium;tetrafluoroborate.
Molecular Properties
| Compound Name | 2-chloro-1-methoxy-4-methylbenzene;(2-phenylchromen-4-ylidene)azanium;tetrafluoroborate |
| PubChem CID | 23411826 |
| Molecular Formula | C23H21BClF4NO2 |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 2-chloro-1-methoxy-4-methylbenzene;(2-phenylchromen-4-ylidene)azanium;tetrafluoroborate |
| SMILES | COc1ccc(C)cc1Cl.F[B-](F)(F)F.[NH2+]=c1cc(-c2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C15H11NO.C8H9ClO.BF4/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;1-6-3-4-8(10-2)7(9)5-6;2-1(3,4)5/h1-10,16H;3-5H,1-2H3;/q;;-1/p+1 |
| InChIKey | PCGCDHOKCSHMHB-UHFFFAOYSA-O |
| XLogP | 5.72 |
| TPSA | 47.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-methoxy-4-methylbenzene;(2-phenylchromen-4-ylidene)azanium;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-methoxy-4-methylbenzene;(2-phenylchromen-4-ylidene)azanium;tetrafluoroborate?
The IUPAC name of 2-chloro-1-methoxy-4-methylbenzene;(2-phenylchromen-4-ylidene)azanium;tetrafluoroborate (CID 23411826) is 2-chloro-1-methoxy-4-methylbenzene;(2-phenylchromen-4-ylidene)azanium;tetrafluoroborate.
What is the SMILES notation for 2-chloro-1-methoxy-4-methylbenzene;(2-phenylchromen-4-ylidene)azanium;tetrafluoroborate?
The canonical SMILES for 2-chloro-1-methoxy-4-methylbenzene;(2-phenylchromen-4-ylidene)azanium;tetrafluoroborate is COc1ccc(C)cc1Cl.F[B-](F)(F)F.[NH2+]=c1cc(-c2ccccc2)oc2ccccc12.
What is the InChIKey of 2-chloro-1-methoxy-4-methylbenzene;(2-phenylchromen-4-ylidene)azanium;tetrafluoroborate?
The InChIKey is PCGCDHOKCSHMHB-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H11NO.C8H9ClO.BF4/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;1-6-3-4-8(10-2)7(9)5-6;2-1(3,4)5/h1-10,16H;3-5H,1-2H3;/q;;-1/p+1.
What are the key properties of 2-chloro-1-methoxy-4-methylbenzene;(2-phenylchromen-4-ylidene)azanium;tetrafluoroborate?
2-chloro-1-methoxy-4-methylbenzene;(2-phenylchromen-4-ylidene)azanium;tetrafluoroborate has a molecular weight of 465.68 g/mol, XLogP of 5.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-methoxy-4-methylbenzene;(2-phenylchromen-4-ylidene)azanium;tetrafluoroborate is sourced from PubChem (CID 23411826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).