C24H21BClF4NO4 — CID 23411989
(3-chloro-4-methoxyphenyl)-[2-(3,4-dimethoxyphenyl)chromen-4-ylidene]azanium tetrafluoroborate (PubChem CID 23411989) has the molecular formula C24H21BClF4NO4 and a molecular weight of 509.69 g/mol. Its IUPAC name is (3-chloro-4-methoxyphenyl)-[2-(3,4-dimethoxyphenyl)chromen-4-ylidene]azanium tetrafluoroborate.
| Compound Name | (3-chloro-4-methoxyphenyl)-[2-(3,4-dimethoxyphenyl)chromen-4-ylidene]azanium tetrafluoroborate |
|---|---|
| PubChem CID | 23411989 |
| Molecular Formula | C24H21BClF4NO4 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | (3-chloro-4-methoxyphenyl)-[2-(3,4-dimethoxyphenyl)chromen-4-ylidene]azanium tetrafluoroborate |
| SMILES | COc1ccc(/[NH+]=c2\cc(-c3ccc(OC)c(OC)c3)oc3ccccc23)cc1Cl.F[B-](F)(F)F |
| InChI | InChI=1S/C24H20ClNO4.BF4/c1-27-21-11-9-16(13-18(21)25)26-19-14-23(30-20-7-5-4-6-17(19)20)15-8-10-22(28-2)24(12-15)29-3;2-1(3,4)5/h4-14H,1-3H3;/q;-1/p+1/b26-19+; |
| InChIKey | ONTXPOFQVMWARG-MGXPCBRFSA-O |
| XLogP | 5.39 |
| TPSA | 54.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|