C23H18ClNO8 — CID 20998329
(6-hydroxy-2-phenylchromen-4-ylidene)-(4-methoxycarbonylphenyl)azanium perchlorate (PubChem CID 20998329) has the molecular formula C23H18ClNO8 and a molecular weight of 471.85 g/mol. Its IUPAC name is (6-hydroxy-2-phenylchromen-4-ylidene)-(4-methoxycarbonylphenyl)azanium perchlorate.
| Compound Name | (6-hydroxy-2-phenylchromen-4-ylidene)-(4-methoxycarbonylphenyl)azanium perchlorate |
|---|---|
| PubChem CID | 20998329 |
| Molecular Formula | C23H18ClNO8 |
| Molecular Weight | 471.85 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | (6-hydroxy-2-phenylchromen-4-ylidene)-(4-methoxycarbonylphenyl)azanium perchlorate |
| SMILES | COC(=O)c1ccc(/[NH+]=c2\cc(-c3ccccc3)oc3ccc(O)cc23)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H17NO4.ClHO4/c1-27-23(26)16-7-9-17(10-8-16)24-20-14-22(15-5-3-2-4-6-15)28-21-12-11-18(25)13-19(20)21;2-1(3,4)5/h2-14,25H,1H3;(H,2,3,4,5)/b24-20+; |
| InChIKey | KWBORJAYTSVHJG-UUTNPJQJSA-N |
| XLogP | -1.85 |
| TPSA | 165.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.85 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |