C22H16ClNO8 — CID 20998325
(3-carboxyphenyl)-(6-hydroxy-2-phenylchromen-4-ylidene)azanium perchlorate (PubChem CID 20998325) has the molecular formula C22H16ClNO8 and a molecular weight of 457.82 g/mol. Its IUPAC name is (3-carboxyphenyl)-(6-hydroxy-2-phenylchromen-4-ylidene)azanium perchlorate.
| Compound Name | (3-carboxyphenyl)-(6-hydroxy-2-phenylchromen-4-ylidene)azanium perchlorate |
|---|---|
| PubChem CID | 20998325 |
| Molecular Formula | C22H16ClNO8 |
| Molecular Weight | 457.82 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | (3-carboxyphenyl)-(6-hydroxy-2-phenylchromen-4-ylidene)azanium perchlorate |
| SMILES | O=C(O)c1cccc(/[NH+]=c2\cc(-c3ccccc3)oc3ccc(O)cc23)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C22H15NO4.ClHO4/c24-17-9-10-20-18(12-17)19(13-21(27-20)14-5-2-1-3-6-14)23-16-8-4-7-15(11-16)22(25)26;2-1(3,4)5/h1-13,24H,(H,25,26);(H,2,3,4,5)/b23-19+; |
| InChIKey | SOKAGXNTVZSQLG-IMPZXOFZSA-N |
| XLogP | -1.94 |
| TPSA | 176.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.82 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |