C24H23BClF4NO — CID 73263601
(6-chloro-2-phenylchromen-4-ylidene)-(3-prop-1-enylhexa-3,5-dienyl)azanium tetrafluoroborate (PubChem CID 73263601) has the molecular formula C24H23BClF4NO and a molecular weight of 463.71 g/mol. Its IUPAC name is (6-chloro-2-phenylchromen-4-ylidene)-(3-prop-1-enylhexa-3,5-dienyl)azanium tetrafluoroborate.
| Compound Name | (6-chloro-2-phenylchromen-4-ylidene)-(3-prop-1-enylhexa-3,5-dienyl)azanium tetrafluoroborate |
|---|---|
| PubChem CID | 73263601 |
| Molecular Formula | C24H23BClF4NO |
| Molecular Weight | 463.71 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | (6-chloro-2-phenylchromen-4-ylidene)-(3-prop-1-enylhexa-3,5-dienyl)azanium tetrafluoroborate |
| SMILES | C=CC=C(C=CC)CC/[NH+]=c1\cc(-c2ccccc2)oc2ccc(Cl)cc12.F[B-](F)(F)F |
| InChI | InChI=1S/C24H22ClNO.BF4/c1-3-8-18(9-4-2)14-15-26-22-17-24(19-10-6-5-7-11-19)27-23-13-12-20(25)16-21(22)23;2-1(3,4)5/h3-13,16-17H,1,14-15H2,2H3;/q;-1/p+1/b9-4?,18-8?,26-22+; |
| InChIKey | KKGJHQPZMHQLAQ-DZCIXRCWSA-O |
| XLogP | 6.11 |
| TPSA | 27.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.71 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|