C21H22O6 — CID 163067078
5,10,11-trimethoxy-2,2-dimethyl-3,4-dihydropyrano[2,3-a]xanthen-12-one (PubChem CID 163067078) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is 5,10,11-trimethoxy-2,2-dimethyl-3,4-dihydropyrano[2,3-a]xanthen-12-one.
| Compound Name | 5,10,11-trimethoxy-2,2-dimethyl-3,4-dihydropyrano[2,3-a]xanthen-12-one |
|---|---|
| PubChem CID | 163067078 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 5,10,11-trimethoxy-2,2-dimethyl-3,4-dihydropyrano[2,3-a]xanthen-12-one |
| SMILES | COc1cc2oc3ccc(OC)c(OC)c3c(=O)c2c2c1CCC(C)(C)O2 |
| InChI | InChI=1S/C21H22O6/c1-21(2)9-8-11-14(24-4)10-15-17(19(11)27-21)18(22)16-12(26-15)6-7-13(23-3)20(16)25-5/h6-7,10H,8-9H2,1-5H3 |
| InChIKey | ISFJUEZGXAJAAE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|