C12H15BrO2 — CID 171049136
5-bromo-8-methoxy-2,2-dimethyl-3,4-dihydrochromene (PubChem CID 171049136) has the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. Its IUPAC name is 5-bromo-8-methoxy-2,2-dimethyl-3,4-dihydrochromene.
| Compound Name | 5-bromo-8-methoxy-2,2-dimethyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 171049136 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 5-bromo-8-methoxy-2,2-dimethyl-3,4-dihydrochromene |
| SMILES | COc1ccc(Br)c2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C12H15BrO2/c1-12(2)7-6-8-9(13)4-5-10(14-3)11(8)15-12/h4-5H,6-7H2,1-3H3 |
| InChIKey | NJCFYVYSJILIRZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |