7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid

C12H14O4 — CID 23296063

IUPAC7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid
SMILESCOc1ccc(C(=O)O)c2c1OC(C)(C)C2
InChIInChI=1S/C12H14O4/c1-12(2)6-8-7(11(13)14)4-5-9(15-3)10(8)16-12/h4-5H,6H2,1-3H3,(H,13,14)
InChIKeyHUWJPQOEEOZWAI-UHFFFAOYSA-N
MW222.24 g/mol
LogP2.11
Rot. Bonds2

About 7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid

7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid (PubChem CID 23296063) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid.

Molecular Properties

Compound Name7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid
PubChem CID23296063
Molecular FormulaC12H14O4
Molecular Weight222.24 g/mol
Exact Mass222.09
IUPAC Name7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid
SMILESCOc1ccc(C(=O)O)c2c1OC(C)(C)C2
InChIInChI=1S/C12H14O4/c1-12(2)6-8-7(11(13)14)4-5-9(15-3)10(8)16-12/h4-5H,6H2,1-3H3,(H,13,14)
InChIKeyHUWJPQOEEOZWAI-UHFFFAOYSA-N
XLogP2.11
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.24
LogP ≤ 52.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid?
The IUPAC name of 7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid (CID 23296063) is 7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid.
What is the SMILES notation for 7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid?
The canonical SMILES for 7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid is COc1ccc(C(=O)O)c2c1OC(C)(C)C2.
What is the InChIKey of 7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid?
The InChIKey is HUWJPQOEEOZWAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-12(2)6-8-7(11(13)14)4-5-9(15-3)10(8)16-12/h4-5H,6H2,1-3H3,(H,13,14).
What are the key properties of 7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid?
7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid has a molecular weight of 222.24 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid is sourced from PubChem (CID 23296063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).