C12H14O4 — CID 23296063
7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid (PubChem CID 23296063) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid.
| Compound Name | 7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid |
|---|---|
| PubChem CID | 23296063 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-carboxylic acid |
| SMILES | COc1ccc(C(=O)O)c2c1OC(C)(C)C2 |
| InChI | InChI=1S/C12H14O4/c1-12(2)6-8-7(11(13)14)4-5-9(15-3)10(8)16-12/h4-5H,6H2,1-3H3,(H,13,14) |
| InChIKey | HUWJPQOEEOZWAI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |