4-methoxy-2,3-bis(oxiran-2-ylmethyl)benzoic acid

C14H16O5 — CID 174602362

IUPAC4-methoxy-2,3-bis(oxiran-2-ylmethyl)benzoic acid
SMILESCOc1ccc(C(=O)O)c(CC2CO2)c1CC1CO1
InChIInChI=1S/C14H16O5/c1-17-13-3-2-10(14(15)16)11(4-8-6-18-8)12(13)5-9-7-19-9/h2-3,8-9H,4-7H2,1H3,(H,15,16)
InChIKeyRBVLWIQNEODHCJ-UHFFFAOYSA-N
MW264.28 g/mol
LogP1.28
Rot. Bonds6

About 4-methoxy-2,3-bis(oxiran-2-ylmethyl)benzoic acid

4-methoxy-2,3-bis(oxiran-2-ylmethyl)benzoic acid (PubChem CID 174602362) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-methoxy-2,3-bis(oxiran-2-ylmethyl)benzoic acid.

Molecular Properties

Compound Name4-methoxy-2,3-bis(oxiran-2-ylmethyl)benzoic acid
PubChem CID174602362
Molecular FormulaC14H16O5
Molecular Weight264.28 g/mol
Exact Mass264.10
IUPAC Name4-methoxy-2,3-bis(oxiran-2-ylmethyl)benzoic acid
SMILESCOc1ccc(C(=O)O)c(CC2CO2)c1CC1CO1
InChIInChI=1S/C14H16O5/c1-17-13-3-2-10(14(15)16)11(4-8-6-18-8)12(13)5-9-7-19-9/h2-3,8-9H,4-7H2,1H3,(H,15,16)
InChIKeyRBVLWIQNEODHCJ-UHFFFAOYSA-N
XLogP1.28
TPSA71.59 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.28
LogP ≤ 51.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze 4-methoxy-2,3-bis(oxiran-2-ylmethyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methoxy-2,3-bis(oxiran-2-ylmethyl)benzoic acid?
The IUPAC name of 4-methoxy-2,3-bis(oxiran-2-ylmethyl)benzoic acid (CID 174602362) is 4-methoxy-2,3-bis(oxiran-2-ylmethyl)benzoic acid.
What is the SMILES notation for 4-methoxy-2,3-bis(oxiran-2-ylmethyl)benzoic acid?
The canonical SMILES for 4-methoxy-2,3-bis(oxiran-2-ylmethyl)benzoic acid is COc1ccc(C(=O)O)c(CC2CO2)c1CC1CO1.
What is the InChIKey of 4-methoxy-2,3-bis(oxiran-2-ylmethyl)benzoic acid?
The InChIKey is RBVLWIQNEODHCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O5/c1-17-13-3-2-10(14(15)16)11(4-8-6-18-8)12(13)5-9-7-19-9/h2-3,8-9H,4-7H2,1H3,(H,15,16).
What are the key properties of 4-methoxy-2,3-bis(oxiran-2-ylmethyl)benzoic acid?
4-methoxy-2,3-bis(oxiran-2-ylmethyl)benzoic acid has a molecular weight of 264.28 g/mol, XLogP of 1.28, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,3-bis(oxiran-2-ylmethyl)benzoic acid is sourced from PubChem (CID 174602362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).