C12H9NO2 — CID 146170101
1,2-dihydrochromeno[4,3-b]pyridin-5-one (PubChem CID 146170101) has the molecular formula C12H9NO2 and a molecular weight of 199.21 g/mol. Its IUPAC name is 1,2-dihydrochromeno[4,3-b]pyridin-5-one.
| Compound Name | 1,2-dihydrochromeno[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 146170101 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 1,2-dihydrochromeno[4,3-b]pyridin-5-one |
| SMILES | O=c1oc2ccccc2c2c1C=CCN2 |
| InChI | InChI=1S/C12H9NO2/c14-12-9-5-3-7-13-11(9)8-4-1-2-6-10(8)15-12/h1-6,13H,7H2 |
| InChIKey | MJCAFYRMDPJUEN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|