C10H8N2O — CID 54182020
1,2-dihydro-[1]benzofuro[2,3-d]pyrimidine (PubChem CID 54182020) has the molecular formula C10H8N2O and a molecular weight of 172.19 g/mol. Its IUPAC name is 1,2-dihydro-[1]benzofuro[2,3-d]pyrimidine.
| Compound Name | 1,2-dihydro-[1]benzofuro[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 54182020 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 1,2-dihydro-[1]benzofuro[2,3-d]pyrimidine |
| SMILES | C1=NCNc2oc3ccccc3c21 |
| InChI | InChI=1S/C10H8N2O/c1-2-4-9-7(3-1)8-5-11-6-12-10(8)13-9/h1-5,12H,6H2 |
| InChIKey | GLYFGOMPJYNDQE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |