C11H9NO — CID 14030965
3,4-dihydro-[1]benzofuro[3,2-c]pyridine (PubChem CID 14030965) has the molecular formula C11H9NO and a molecular weight of 171.20 g/mol. Its IUPAC name is 3,4-dihydro-[1]benzofuro[3,2-c]pyridine.
| Compound Name | 3,4-dihydro-[1]benzofuro[3,2-c]pyridine |
|---|---|
| PubChem CID | 14030965 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 3,4-dihydro-[1]benzofuro[3,2-c]pyridine |
| SMILES | C1=NCCc2oc3ccccc3c21 |
| InChI | InChI=1S/C11H9NO/c1-2-4-10-8(3-1)9-7-12-6-5-11(9)13-10/h1-4,7H,5-6H2 |
| InChIKey | ALJQLDRMCPKRHA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |