C13H10O3 — CID 102501574
2,4-dihydro-1H-xanthene-3,9-dione (PubChem CID 102501574) has the molecular formula C13H10O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2,4-dihydro-1H-xanthene-3,9-dione.
| Compound Name | 2,4-dihydro-1H-xanthene-3,9-dione |
|---|---|
| PubChem CID | 102501574 |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2,4-dihydro-1H-xanthene-3,9-dione |
| SMILES | O=C1CCc2c(oc3ccccc3c2=O)C1 |
| InChI | InChI=1S/C13H10O3/c14-8-5-6-10-12(7-8)16-11-4-2-1-3-9(11)13(10)15/h1-4H,5-7H2 |
| InChIKey | WIHUOCIOUFVEOX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |