About 1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one
1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one (PubChem CID 174814629) has the molecular formula C12H8O4S
and a molecular weight of 248.26 g/mol. Its IUPAC name is 1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one.
Molecular Properties
| Compound Name | 1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one |
| PubChem CID | 174814629 |
| Molecular Formula | C12H8O4S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one |
| SMILES | O=c1c2c(oc3ccccc13)C=CCS2(=O)=O |
| InChI | InChI=1S/C12H8O4S/c13-11-8-4-1-2-5-9(8)16-10-6-3-7-17(14,15)12(10)11/h1-6H,7H2 |
| InChIKey | UPZVWPFBCRYJJC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one?
The IUPAC name of 1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one (CID 174814629) is 1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one.
What is the SMILES notation for 1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one?
The canonical SMILES for 1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one is O=c1c2c(oc3ccccc13)C=CCS2(=O)=O.
What is the InChIKey of 1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one?
The InChIKey is UPZVWPFBCRYJJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O4S/c13-11-8-4-1-2-5-9(8)16-10-6-3-7-17(14,15)12(10)11/h1-6H,7H2.
What are the key properties of 1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one?
1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one has a molecular weight of 248.26 g/mol, XLogP of 1.59, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one is sourced from PubChem (CID 174814629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).