C12H8O4S — CID 174814629
1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one (PubChem CID 174814629) has the molecular formula C12H8O4S and a molecular weight of 248.26 g/mol. Its IUPAC name is 1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one.
| Compound Name | 1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one |
|---|---|
| PubChem CID | 174814629 |
| Molecular Formula | C12H8O4S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 1,1-dioxo-2H-thiopyrano[3,2-b]chromen-10-one |
| SMILES | O=c1c2c(oc3ccccc13)C=CCS2(=O)=O |
| InChI | InChI=1S/C12H8O4S/c13-11-8-4-1-2-5-9(8)16-10-6-3-7-17(14,15)12(10)11/h1-6H,7H2 |
| InChIKey | UPZVWPFBCRYJJC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |