C16H12O2S2 — CID 174831002
thiophene;2H-thiopyrano[3,2-b]chromen-10-one (PubChem CID 174831002) has the molecular formula C16H12O2S2 and a molecular weight of 300.40 g/mol. Its IUPAC name is thiophene;2H-thiopyrano[3,2-b]chromen-10-one.
| Compound Name | thiophene;2H-thiopyrano[3,2-b]chromen-10-one |
|---|---|
| PubChem CID | 174831002 |
| Molecular Formula | C16H12O2S2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | thiophene;2H-thiopyrano[3,2-b]chromen-10-one |
| SMILES | O=c1c2c(oc3ccccc13)C=CCS2.c1ccsc1 |
| InChI | InChI=1S/C12H8O2S.C4H4S/c13-11-8-4-1-2-5-9(8)14-10-6-3-7-15-12(10)11;1-2-4-5-3-1/h1-6H,7H2;1-4H |
| InChIKey | HSBNGRSLJFBXAS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |