C21H16O5S — CID 174828124
formyl 2-methylbenzoate;2H-thiopyrano[3,2-b]chromen-10-one (PubChem CID 174828124) has the molecular formula C21H16O5S and a molecular weight of 380.42 g/mol. Its IUPAC name is formyl 2-methylbenzoate;2H-thiopyrano[3,2-b]chromen-10-one.
| Compound Name | formyl 2-methylbenzoate;2H-thiopyrano[3,2-b]chromen-10-one |
|---|---|
| PubChem CID | 174828124 |
| Molecular Formula | C21H16O5S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | formyl 2-methylbenzoate;2H-thiopyrano[3,2-b]chromen-10-one |
| SMILES | Cc1ccccc1C(=O)OC=O.O=c1c2c(oc3ccccc13)C=CCS2 |
| InChI | InChI=1S/C12H8O2S.C9H8O3/c13-11-8-4-1-2-5-9(8)14-10-6-3-7-15-12(10)11;1-7-4-2-3-5-8(7)9(11)12-6-10/h1-6H,7H2;2-6H,1H3 |
| InChIKey | LIMAJHBFPHROTI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|