About (10-oxo-2H-thiopyrano[3,2-b]chromen-2-yl) thiohypochlorite
(10-oxo-2H-thiopyrano[3,2-b]chromen-2-yl) thiohypochlorite (PubChem CID 174797485) has the molecular formula C12H7ClO2S2
and a molecular weight of 282.77 g/mol. Its IUPAC name is (10-oxo-2H-thiopyrano[3,2-b]chromen-2-yl) thiohypochlorite.
Analyze (10-oxo-2H-thiopyrano[3,2-b]chromen-2-yl) thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10-oxo-2H-thiopyrano[3,2-b]chromen-2-yl) thiohypochlorite?
The IUPAC name of (10-oxo-2H-thiopyrano[3,2-b]chromen-2-yl) thiohypochlorite (CID 174797485) is (10-oxo-2H-thiopyrano[3,2-b]chromen-2-yl) thiohypochlorite.
What is the SMILES notation for (10-oxo-2H-thiopyrano[3,2-b]chromen-2-yl) thiohypochlorite?
The canonical SMILES for (10-oxo-2H-thiopyrano[3,2-b]chromen-2-yl) thiohypochlorite is O=c1c2c(oc3ccccc13)C=CC(SCl)S2.
What is the InChIKey of (10-oxo-2H-thiopyrano[3,2-b]chromen-2-yl) thiohypochlorite?
The InChIKey is BDKBNEBTKNMQMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7ClO2S2/c13-17-10-6-5-9-12(16-10)11(14)7-3-1-2-4-8(7)15-9/h1-6,10H.
What are the key properties of (10-oxo-2H-thiopyrano[3,2-b]chromen-2-yl) thiohypochlorite?
(10-oxo-2H-thiopyrano[3,2-b]chromen-2-yl) thiohypochlorite has a molecular weight of 282.77 g/mol, XLogP of 4.12, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (10-oxo-2H-thiopyrano[3,2-b]chromen-2-yl) thiohypochlorite is sourced from PubChem (CID 174797485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).