C12H7ClO2S — CID 154367081
3-chloro-2H-thiopyrano[3,2-b]chromen-10-one (PubChem CID 154367081) has the molecular formula C12H7ClO2S and a molecular weight of 250.71 g/mol. Its IUPAC name is 3-chloro-2H-thiopyrano[3,2-b]chromen-10-one.
| Compound Name | 3-chloro-2H-thiopyrano[3,2-b]chromen-10-one |
|---|---|
| PubChem CID | 154367081 |
| Molecular Formula | C12H7ClO2S |
| Molecular Weight | 250.71 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | 3-chloro-2H-thiopyrano[3,2-b]chromen-10-one |
| SMILES | O=c1c2c(oc3ccccc13)C=C(Cl)CS2 |
| InChI | InChI=1S/C12H7ClO2S/c13-7-5-10-12(16-6-7)11(14)8-3-1-2-4-9(8)15-10/h1-5H,6H2 |
| InChIKey | LFFAAPQQAVPHQV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.71 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |