C12H9ClO4 — CID 130761207
4-chloro-3-(1,3-dioxolan-2-yl)chromen-2-one (PubChem CID 130761207) has the molecular formula C12H9ClO4 and a molecular weight of 252.65 g/mol. Its IUPAC name is 4-chloro-3-(1,3-dioxolan-2-yl)chromen-2-one.
| Compound Name | 4-chloro-3-(1,3-dioxolan-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 130761207 |
| Molecular Formula | C12H9ClO4 |
| Molecular Weight | 252.65 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 4-chloro-3-(1,3-dioxolan-2-yl)chromen-2-one |
| SMILES | O=c1oc2ccccc2c(Cl)c1C1OCCO1 |
| InChI | InChI=1S/C12H9ClO4/c13-10-7-3-1-2-4-8(7)17-11(14)9(10)12-15-5-6-16-12/h1-4,12H,5-6H2 |
| InChIKey | YVMQAONWNDVAIF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.65 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|