C12H7Cl3O2 — CID 15322911
4-chloro-3-(3,3-dichloroprop-2-enyl)chromen-2-one (PubChem CID 15322911) has the molecular formula C12H7Cl3O2 and a molecular weight of 289.55 g/mol. Its IUPAC name is 4-chloro-3-(3,3-dichloroprop-2-enyl)chromen-2-one.
| Compound Name | 4-chloro-3-(3,3-dichloroprop-2-enyl)chromen-2-one |
|---|---|
| PubChem CID | 15322911 |
| Molecular Formula | C12H7Cl3O2 |
| Molecular Weight | 289.55 g/mol |
| Exact Mass | 287.95 |
| IUPAC Name | 4-chloro-3-(3,3-dichloroprop-2-enyl)chromen-2-one |
| SMILES | O=c1oc2ccccc2c(Cl)c1CC=C(Cl)Cl |
| InChI | InChI=1S/C12H7Cl3O2/c13-10(14)6-5-8-11(15)7-3-1-2-4-9(7)17-12(8)16/h1-4,6H,5H2 |
| InChIKey | NZAWZQIXOCGOOH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|