About acetic acid;3-benzyl-4-hydroxychromen-2-one;methane
acetic acid;3-benzyl-4-hydroxychromen-2-one;methane (PubChem CID 160553428) has the molecular formula C19H20O5
and a molecular weight of 328.36 g/mol. Its IUPAC name is acetic acid;3-benzyl-4-hydroxychromen-2-one;methane.
Molecular Properties
| Compound Name | acetic acid;3-benzyl-4-hydroxychromen-2-one;methane |
| PubChem CID | 160553428 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | acetic acid;3-benzyl-4-hydroxychromen-2-one;methane |
| SMILES | C.CC(=O)O.O=c1oc2ccccc2c(O)c1Cc1ccccc1 |
| InChI | InChI=1S/C16H12O3.C2H4O2.CH4/c17-15-12-8-4-5-9-14(12)19-16(18)13(15)10-11-6-2-1-3-7-11;1-2(3)4;/h1-9,17H,10H2;1H3,(H,3,4);1H4 |
| InChIKey | KNPXDOUCBCUWQB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;3-benzyl-4-hydroxychromen-2-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;3-benzyl-4-hydroxychromen-2-one;methane?
The IUPAC name of acetic acid;3-benzyl-4-hydroxychromen-2-one;methane (CID 160553428) is acetic acid;3-benzyl-4-hydroxychromen-2-one;methane.
What is the SMILES notation for acetic acid;3-benzyl-4-hydroxychromen-2-one;methane?
The canonical SMILES for acetic acid;3-benzyl-4-hydroxychromen-2-one;methane is C.CC(=O)O.O=c1oc2ccccc2c(O)c1Cc1ccccc1.
What is the InChIKey of acetic acid;3-benzyl-4-hydroxychromen-2-one;methane?
The InChIKey is KNPXDOUCBCUWQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O3.C2H4O2.CH4/c17-15-12-8-4-5-9-14(12)19-16(18)13(15)10-11-6-2-1-3-7-11;1-2(3)4;/h1-9,17H,10H2;1H3,(H,3,4);1H4.
What are the key properties of acetic acid;3-benzyl-4-hydroxychromen-2-one;methane?
acetic acid;3-benzyl-4-hydroxychromen-2-one;methane has a molecular weight of 328.36 g/mol, XLogP of 3.82, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3-benzyl-4-hydroxychromen-2-one;methane is sourced from PubChem (CID 160553428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).