C21H15F5O5 — CID 58930724
[(2S)-3,3,4,4,4-pentafluorobutan-2-yl] 4-[(4-hydroxy-2-oxochromen-3-yl)methyl]benzoate (PubChem CID 58930724) has the molecular formula C21H15F5O5 and a molecular weight of 442.34 g/mol. Its IUPAC name is [(2S)-3,3,4,4,4-pentafluorobutan-2-yl] 4-[(4-hydroxy-2-oxochromen-3-yl)methyl]benzoate.
| Compound Name | [(2S)-3,3,4,4,4-pentafluorobutan-2-yl] 4-[(4-hydroxy-2-oxochromen-3-yl)methyl]benzoate |
|---|---|
| PubChem CID | 58930724 |
| Molecular Formula | C21H15F5O5 |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | [(2S)-3,3,4,4,4-pentafluorobutan-2-yl] 4-[(4-hydroxy-2-oxochromen-3-yl)methyl]benzoate |
| SMILES | C[C@H](OC(=O)c1ccc(Cc2c(O)c3ccccc3oc2=O)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H15F5O5/c1-11(20(22,23)21(24,25)26)30-18(28)13-8-6-12(7-9-13)10-15-17(27)14-4-2-3-5-16(14)31-19(15)29/h2-9,11,27H,10H2,1H3/t11-/m0/s1 |
| InChIKey | CXRFNPZUQRGAKB-NSHDSACASA-N |
| XLogP | 4.83 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|