C22H15F5O5 — CID 162556744
3,3,4,4,4-pentafluorobutan-2-yl 5-[(4-hydroxy-2-oxochromen-3-yl)methyl]cyclohepta-1,3,4,6-tetraene-1-carboxylate (PubChem CID 162556744) has the molecular formula C22H15F5O5 and a molecular weight of 454.35 g/mol. Its IUPAC name is 3,3,4,4,4-pentafluorobutan-2-yl 5-[(4-hydroxy-2-oxochromen-3-yl)methyl]cyclohepta-1,3,4,6-tetraene-1-carboxylate.
| Compound Name | 3,3,4,4,4-pentafluorobutan-2-yl 5-[(4-hydroxy-2-oxochromen-3-yl)methyl]cyclohepta-1,3,4,6-tetraene-1-carboxylate |
|---|---|
| PubChem CID | 162556744 |
| Molecular Formula | C22H15F5O5 |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 3,3,4,4,4-pentafluorobutan-2-yl 5-[(4-hydroxy-2-oxochromen-3-yl)methyl]cyclohepta-1,3,4,6-tetraene-1-carboxylate |
| SMILES | CC(OC(=O)C1=CC=C=C(Cc2c(O)c3ccccc3oc2=O)C=C1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H15F5O5/c1-12(21(23,24)22(25,26)27)31-19(29)14-6-4-5-13(9-10-14)11-16-18(28)15-7-2-3-8-17(15)32-20(16)30/h2-4,6-10,12,28H,11H2,1H3 |
| InChIKey | JJNKWOPGGYSDJK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|