C20H12ClN3O2S — CID 11567375
4-(2-chloroquinolin-3-yl)-2-sulfanylidene-3,4-dihydro-1H-chromeno[4,3-d]pyrimidin-5-one (PubChem CID 11567375) has the molecular formula C20H12ClN3O2S and a molecular weight of 393.86 g/mol. Its IUPAC name is 4-(2-chloroquinolin-3-yl)-2-sulfanylidene-3,4-dihydro-1H-chromeno[4,3-d]pyrimidin-5-one.
| Compound Name | 4-(2-chloroquinolin-3-yl)-2-sulfanylidene-3,4-dihydro-1H-chromeno[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 11567375 |
| Molecular Formula | C20H12ClN3O2S |
| Molecular Weight | 393.86 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 4-(2-chloroquinolin-3-yl)-2-sulfanylidene-3,4-dihydro-1H-chromeno[4,3-d]pyrimidin-5-one |
| SMILES | O=c1oc2ccccc2c2c1C(c1cc3ccccc3nc1Cl)NC(=S)N2 |
| InChI | InChI=1S/C20H12ClN3O2S/c21-18-12(9-10-5-1-3-7-13(10)22-18)17-15-16(23-20(27)24-17)11-6-2-4-8-14(11)26-19(15)25/h1-9,17H,(H2,23,24,27) |
| InChIKey | BRKVQRSKFKYJBV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.86 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|