C15H10N2O2S2 — CID 101461194
2-sulfanylidene-4-thiophen-2-yl-3,4-dihydro-1H-chromeno[4,3-d]pyrimidin-5-one (PubChem CID 101461194) has the molecular formula C15H10N2O2S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-sulfanylidene-4-thiophen-2-yl-3,4-dihydro-1H-chromeno[4,3-d]pyrimidin-5-one.
| Compound Name | 2-sulfanylidene-4-thiophen-2-yl-3,4-dihydro-1H-chromeno[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 101461194 |
| Molecular Formula | C15H10N2O2S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 2-sulfanylidene-4-thiophen-2-yl-3,4-dihydro-1H-chromeno[4,3-d]pyrimidin-5-one |
| SMILES | O=c1oc2ccccc2c2c1C(c1cccs1)NC(=S)N2 |
| InChI | InChI=1S/C15H10N2O2S2/c18-14-11-12(8-4-1-2-5-9(8)19-14)16-15(20)17-13(11)10-6-3-7-21-10/h1-7,13H,(H2,16,17,20) |
| InChIKey | IIUHYPWDWMIWHP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|