C18H12N2O5 — CID 2476563
(4R)-4-(1,3-benzodioxol-5-yl)-3,4-dihydro-1H-chromeno[4,3-d]pyrimidine-2,5-dione (PubChem CID 2476563) has the molecular formula C18H12N2O5 and a molecular weight of 336.30 g/mol. Its IUPAC name is (4R)-4-(1,3-benzodioxol-5-yl)-3,4-dihydro-1H-chromeno[4,3-d]pyrimidine-2,5-dione.
| Compound Name | (4R)-4-(1,3-benzodioxol-5-yl)-3,4-dihydro-1H-chromeno[4,3-d]pyrimidine-2,5-dione |
|---|---|
| PubChem CID | 2476563 |
| Molecular Formula | C18H12N2O5 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | (4R)-4-(1,3-benzodioxol-5-yl)-3,4-dihydro-1H-chromeno[4,3-d]pyrimidine-2,5-dione |
| SMILES | O=C1Nc2c(c(=O)oc3ccccc23)[C@@H](c2ccc3c(c2)OCO3)N1 |
| InChI | InChI=1S/C18H12N2O5/c21-17-14-15(9-5-6-12-13(7-9)24-8-23-12)19-18(22)20-16(14)10-3-1-2-4-11(10)25-17/h1-7,15H,8H2,(H2,19,20,22)/t15-/m1/s1 |
| InChIKey | MWVHGZKXKNUWJB-OAHLLOKOSA-N |
| XLogP | 2.75 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|