C17H18N2O4 — CID 11631043
4-(1,3-benzodioxol-5-yl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione (PubChem CID 11631043) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione |
|---|---|
| PubChem CID | 11631043 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC(=O)NC2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H18N2O4/c1-17(2)6-10-14(11(20)7-17)15(19-16(21)18-10)9-3-4-12-13(5-9)23-8-22-12/h3-5,15H,6-8H2,1-2H3,(H2,18,19,21) |
| InChIKey | NAZKUCDMABRXES-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |