C18H22N2O4 — CID 7571677
(4R)-4-(3,4-dimethoxyphenyl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione (PubChem CID 7571677) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is (4R)-4-(3,4-dimethoxyphenyl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione.
| Compound Name | (4R)-4-(3,4-dimethoxyphenyl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione |
|---|---|
| PubChem CID | 7571677 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (4R)-4-(3,4-dimethoxyphenyl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione |
| SMILES | COc1ccc([C@H]2NC(=O)NC3=C2C(=O)CC(C)(C)C3)cc1OC |
| InChI | InChI=1S/C18H22N2O4/c1-18(2)8-11-15(12(21)9-18)16(20-17(22)19-11)10-5-6-13(23-3)14(7-10)24-4/h5-7,16H,8-9H2,1-4H3,(H2,19,20,22)/t16-/m1/s1 |
| InChIKey | GUDHMBKCNFNONV-MRXNPFEDSA-N |
| XLogP | 2.70 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |