C17H19IN2O4 — CID 92838108
(4R)-4-(4-hydroxy-3-iodo-5-methoxyphenyl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione (PubChem CID 92838108) has the molecular formula C17H19IN2O4 and a molecular weight of 442.25 g/mol. Its IUPAC name is (4R)-4-(4-hydroxy-3-iodo-5-methoxyphenyl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione.
| Compound Name | (4R)-4-(4-hydroxy-3-iodo-5-methoxyphenyl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione |
|---|---|
| PubChem CID | 92838108 |
| Molecular Formula | C17H19IN2O4 |
| Molecular Weight | 442.25 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | (4R)-4-(4-hydroxy-3-iodo-5-methoxyphenyl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione |
| SMILES | COc1cc([C@H]2NC(=O)NC3=C2C(=O)CC(C)(C)C3)cc(I)c1O |
| InChI | InChI=1S/C17H19IN2O4/c1-17(2)6-10-13(11(21)7-17)14(20-16(23)19-10)8-4-9(18)15(22)12(5-8)24-3/h4-5,14,22H,6-7H2,1-3H3,(H2,19,20,23)/t14-/m1/s1 |
| InChIKey | NJFUTNDTTYTGEJ-CQSZACIVSA-N |
| XLogP | 3.00 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|