C18H19NO4 — CID 7075014
(4R)-4-(1,3-benzodioxol-5-yl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinoline-2,5-dione (PubChem CID 7075014) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is (4R)-4-(1,3-benzodioxol-5-yl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinoline-2,5-dione.
| Compound Name | (4R)-4-(1,3-benzodioxol-5-yl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinoline-2,5-dione |
|---|---|
| PubChem CID | 7075014 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (4R)-4-(1,3-benzodioxol-5-yl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinoline-2,5-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC(=O)C[C@@H]2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H19NO4/c1-18(2)7-12-17(13(20)8-18)11(6-16(21)19-12)10-3-4-14-15(5-10)23-9-22-14/h3-5,11H,6-9H2,1-2H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | FVHSYISIKIICPU-LLVKDONJSA-N |
| XLogP | 2.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |