C26H25FN2O4 — CID 2900697
4-(1,3-benzodioxol-5-yl)-N-(4-fluorophenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 2900697) has the molecular formula C26H25FN2O4 and a molecular weight of 448.49 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-N-(4-fluorophenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-N-(4-fluorophenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 2900697 |
| Molecular Formula | C26H25FN2O4 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-N-(4-fluorophenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(F)cc2)C(c2ccc3c(c2)OCO3)C2=C(CC(C)(C)CC2=O)N1 |
| InChI | InChI=1S/C26H25FN2O4/c1-14-22(25(31)29-17-7-5-16(27)6-8-17)23(15-4-9-20-21(10-15)33-13-32-20)24-18(28-14)11-26(2,3)12-19(24)30/h4-10,23,28H,11-13H2,1-3H3,(H,29,31) |
| InChIKey | HGPREYSTCQCCGA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |