C28H31FN2O5 — CID 1023452
(4S)-N-(4-fluorophenyl)-2,7,7-trimethyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 1023452) has the molecular formula C28H31FN2O5 and a molecular weight of 494.56 g/mol. Its IUPAC name is (4S)-N-(4-fluorophenyl)-2,7,7-trimethyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | (4S)-N-(4-fluorophenyl)-2,7,7-trimethyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 1023452 |
| Molecular Formula | C28H31FN2O5 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | (4S)-N-(4-fluorophenyl)-2,7,7-trimethyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | COc1cc([C@@H]2C(C(=O)Nc3ccc(F)cc3)=C(C)NC3=C2C(=O)CC(C)(C)C3)cc(OC)c1OC |
| InChI | InChI=1S/C28H31FN2O5/c1-15-23(27(33)31-18-9-7-17(29)8-10-18)24(25-19(30-15)13-28(2,3)14-20(25)32)16-11-21(34-4)26(36-6)22(12-16)35-5/h7-12,24,30H,13-14H2,1-6H3,(H,31,33)/t24-/m1/s1 |
| InChIKey | AZCZRVBYWDUWCJ-XMMPIXPASA-N |
| XLogP | 5.09 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |